C6H10N4O10 — CID 13405045
2,3-dimethoxy-1,1,4,4-tetranitrobutane (PubChem CID 13405045) has the molecular formula C6H10N4O10 and a molecular weight of 298.16 g/mol. Its IUPAC name is 2,3-dimethoxy-1,1,4,4-tetranitrobutane.
| Compound Name | 2,3-dimethoxy-1,1,4,4-tetranitrobutane |
|---|---|
| PubChem CID | 13405045 |
| Molecular Formula | C6H10N4O10 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2,3-dimethoxy-1,1,4,4-tetranitrobutane |
| SMILES | COC(C(OC)C([N+](=O)[O-])[N+](=O)[O-])C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N4O10/c1-19-3(5(7(11)12)8(13)14)4(20-2)6(9(15)16)10(17)18/h3-6H,1-2H3 |
| InChIKey | VINISDUFEYEQHR-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|