About 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide
1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide (PubChem CID 134051257) has the molecular formula C22H22N4O3
and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide.
Molecular Properties
| Compound Name | 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide |
| PubChem CID | 134051257 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)CCC2Cc3ccccc3NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O3/c1-26-13-17(16-7-3-5-9-19(16)26)22(29)25-24-20(27)11-10-15-12-14-6-2-4-8-18(14)23-21(15)28/h2-9,13,15H,10-12H2,1H3,(H,23,28)(H,24,27)(H,25,29) |
| InChIKey | PZGSINVMWLXGFC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide?
The IUPAC name of 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide (CID 134051257) is 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide.
What is the SMILES notation for 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide?
The canonical SMILES for 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide is Cn1cc(C(=O)NNC(=O)CCC2Cc3ccccc3NC2=O)c2ccccc21.
What is the InChIKey of 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide?
The InChIKey is PZGSINVMWLXGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O3/c1-26-13-17(16-7-3-5-9-19(16)26)22(29)25-24-20(27)11-10-15-12-14-6-2-4-8-18(14)23-21(15)28/h2-9,13,15H,10-12H2,1H3,(H,23,28)(H,24,27)(H,25,29).
What are the key properties of 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide?
1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide has a molecular weight of 390.44 g/mol, XLogP of 2.53, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N'-[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoyl]indole-3-carbohydrazide is sourced from PubChem (CID 134051257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).