C10H15NO2 — CID 13405154
(2E,4E)-1-morpholin-4-ylhexa-2,4-dien-1-one (PubChem CID 13405154) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is (2E,4E)-1-morpholin-4-ylhexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-morpholin-4-ylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 13405154 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2E,4E)-1-morpholin-4-ylhexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H15NO2/c1-2-3-4-5-10(12)11-6-8-13-9-7-11/h2-5H,6-9H2,1H3/b3-2+,5-4+ |
| InChIKey | YHFCLKOVFYITAG-MQQKCMAXSA-N |
| XLogP | 0.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|