C16H28N2O2 — CID 134053198
(2E,4E)-N-(4-methyl-2-morpholin-4-ylpentyl)hexa-2,4-dienamide (PubChem CID 134053198) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2E,4E)-N-(4-methyl-2-morpholin-4-ylpentyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(4-methyl-2-morpholin-4-ylpentyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 134053198 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (2E,4E)-N-(4-methyl-2-morpholin-4-ylpentyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C16H28N2O2/c1-4-5-6-7-16(19)17-13-15(12-14(2)3)18-8-10-20-11-9-18/h4-7,14-15H,8-13H2,1-3H3,(H,17,19)/b5-4+,7-6+ |
| InChIKey | FVYUMWHMXNPPPJ-YTXTXJHMSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|