C22H26N6O — CID 134053570
[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone (PubChem CID 134053570) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 134053570 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [4-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(c2cnccn2)CC1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H26N6O/c29-22(17-7-11-27(12-8-17)20-15-23-9-10-24-20)28-13-5-16(6-14-28)21-25-18-3-1-2-4-19(18)26-21/h1-4,9-10,15-17H,5-8,11-14H2,(H,25,26) |
| InChIKey | XCTXHWCQNLJWNP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |