C18H27N3O3 — CID 134053863
N-[1-(2,4-dimethoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-7-carboxamide (PubChem CID 134053863) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-7-carboxamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 134053863 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-7-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)C2CCCC3CNNC32)c(OC)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-11(14-8-7-13(23-2)9-16(14)24-3)20-18(22)15-6-4-5-12-10-19-21-17(12)15/h7-9,11-12,15,17,19,21H,4-6,10H2,1-3H3,(H,20,22) |
| InChIKey | LKLDYYASLLHKEO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |