C13H17N — CID 13405457
(1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]heptan-2-amine (PubChem CID 13405457) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 13405457 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (1S,2R,3R,4R)-3-phenylbicyclo[2.2.1]heptan-2-amine |
| SMILES | N[C@@H]1[C@H]2CC[C@H](C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17N/c14-13-11-7-6-10(8-11)12(13)9-4-2-1-3-5-9/h1-5,10-13H,6-8,14H2/t10-,11+,12+,13-/m1/s1 |
| InChIKey | YESNBFAEPGJCQQ-MROQNXINSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |