About N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide
N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 1340554) has the molecular formula C24H17N3O3S
and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| PubChem CID | 1340554 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(-c2nc3ccccc3o2)cc1NC(=S)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H17N3O3S/c1-14-10-11-16(23-25-17-7-3-5-9-20(17)30-23)12-18(14)26-24(31)27-22(28)21-13-15-6-2-4-8-19(15)29-21/h2-13H,1H3,(H2,26,27,28,31) |
| InChIKey | BZMVGAFWPUQNHC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide?
The IUPAC name of N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide (CID 1340554) is N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide?
The canonical SMILES for N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide is Cc1ccc(-c2nc3ccccc3o2)cc1NC(=S)NC(=O)c1cc2ccccc2o1.
What is the InChIKey of N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide?
The InChIKey is BZMVGAFWPUQNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O3S/c1-14-10-11-16(23-25-17-7-3-5-9-20(17)30-23)12-18(14)26-24(31)27-22(28)21-13-15-6-2-4-8-19(15)29-21/h2-13H,1H3,(H2,26,27,28,31).
What are the key properties of N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide?
N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide has a molecular weight of 427.49 g/mol, XLogP of 5.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 1340554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).