C14H22N2O2 — CID 134055540
cyclohexyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 134055540) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is cyclohexyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate.
| Compound Name | cyclohexyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 134055540 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | cyclohexyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | Cc1nn(C)c(C)c1CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C14H22N2O2/c1-10-13(11(2)16(3)15-10)9-14(17)18-12-7-5-4-6-8-12/h12H,4-9H2,1-3H3 |
| InChIKey | LGWOPJRAFUDJDW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |