About 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one
7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one (PubChem CID 13405592) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one.
Molecular Properties
| Compound Name | 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one |
| PubChem CID | 13405592 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one |
| SMILES | C=C1Cc2c1cc[nH]c2=O |
| InChI | InChI=1S/C8H7NO/c1-5-4-7-6(5)2-3-9-8(7)10/h2-3H,1,4H2,(H,9,10) |
| InChIKey | BKCFXCLVYKNLIJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one?
The IUPAC name of 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one (CID 13405592) is 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one.
What is the SMILES notation for 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one?
The canonical SMILES for 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one is C=C1Cc2c1cc[nH]c2=O.
What is the InChIKey of 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one?
The InChIKey is BKCFXCLVYKNLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c1-5-4-7-6(5)2-3-9-8(7)10/h2-3H,1,4H2,(H,9,10).
What are the key properties of 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one?
7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one has a molecular weight of 133.15 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-3-azabicyclo[4.2.0]octa-1(6),4-dien-2-one is sourced from PubChem (CID 13405592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).