C22H24N4O2 — CID 134056711
(E)-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 134056711) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134056711 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (E)-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCN(Cc3cn4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C22H24N4O2/c1-28-20-6-4-5-18(15-20)8-9-22(27)25-13-11-24(12-14-25)16-19-17-26-10-3-2-7-21(26)23-19/h2-10,15,17H,11-14,16H2,1H3/b9-8+ |
| InChIKey | YAQKPJADEMNUEY-CMDGGOBGSA-N |
| XLogP | 2.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|