C16H24BrN3O3S — CID 134057435
N-[3-(azepan-1-yl)propyl]-2-bromo-5-sulfamoylbenzamide (PubChem CID 134057435) has the molecular formula C16H24BrN3O3S and a molecular weight of 418.36 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-2-bromo-5-sulfamoylbenzamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-2-bromo-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 134057435 |
| Molecular Formula | C16H24BrN3O3S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-2-bromo-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Br)c(C(=O)NCCCN2CCCCCC2)c1 |
| InChI | InChI=1S/C16H24BrN3O3S/c17-15-7-6-13(24(18,22)23)12-14(15)16(21)19-8-5-11-20-9-3-1-2-4-10-20/h6-7,12H,1-5,8-11H2,(H,19,21)(H2,18,22,23) |
| InChIKey | YZHPUUXDBIDALL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|