C18H22ClNO3 — CID 134057444
1-(4-chlorophenyl)ethyl 1-(cyclopropanecarbonyl)piperidine-4-carboxylate (PubChem CID 134057444) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)ethyl 1-(cyclopropanecarbonyl)piperidine-4-carboxylate.
| Compound Name | 1-(4-chlorophenyl)ethyl 1-(cyclopropanecarbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 134057444 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-(4-chlorophenyl)ethyl 1-(cyclopropanecarbonyl)piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(C(=O)C2CC2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO3/c1-12(13-4-6-16(19)7-5-13)23-18(22)15-8-10-20(11-9-15)17(21)14-2-3-14/h4-7,12,14-15H,2-3,8-11H2,1H3 |
| InChIKey | FOVCGDZGDAKZIL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |