C17H32N2O — CID 134062663
1,2-bis(3,5-dimethylpiperidin-1-yl)propan-1-one (PubChem CID 134062663) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,2-bis(3,5-dimethylpiperidin-1-yl)propan-1-one.
| Compound Name | 1,2-bis(3,5-dimethylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 134062663 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 1,2-bis(3,5-dimethylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CC(C)CN(C(=O)C(C)N2CC(C)CC(C)C2)C1 |
| InChI | InChI=1S/C17H32N2O/c1-12-6-13(2)9-18(8-12)16(5)17(20)19-10-14(3)7-15(4)11-19/h12-16H,6-11H2,1-5H3 |
| InChIKey | NUBBGPVJEZCZPE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |