C20H30FN3O — CID 134062684
1-(2-ethylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 134062684) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 134062684 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CCC1CCCCN1C(=O)C(C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-3-18-6-4-5-11-24(18)20(25)16(2)22-12-14-23(15-13-22)19-9-7-17(21)8-10-19/h7-10,16,18H,3-6,11-15H2,1-2H3 |
| InChIKey | APSIQEPDYZSNNN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |