C23H22ClN5O5 — CID 134063468
2-chloro-N-[2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazine-1-carbonyl]phenyl]-4-nitrobenzamide (PubChem CID 134063468) has the molecular formula C23H22ClN5O5 and a molecular weight of 483.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazine-1-carbonyl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazine-1-carbonyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 134063468 |
| Molecular Formula | C23H22ClN5O5 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-chloro-N-[2-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazine-1-carbonyl]phenyl]-4-nitrobenzamide |
| SMILES | Cc1cc(CN2CCN(C(=O)c3ccccc3NC(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)on1 |
| InChI | InChI=1S/C23H22ClN5O5/c1-15-12-17(34-26-15)14-27-8-10-28(11-9-27)23(31)19-4-2-3-5-21(19)25-22(30)18-7-6-16(29(32)33)13-20(18)24/h2-7,12-13H,8-11,14H2,1H3,(H,25,30) |
| InChIKey | RYDQLHBZDJMHCO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|