C20H23NO2S — CID 134065103
2-(2-morpholin-4-ylethylsulfanyl)-1,2-diphenylethanone (PubChem CID 134065103) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylsulfanyl)-1,2-diphenylethanone.
| Compound Name | 2-(2-morpholin-4-ylethylsulfanyl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 134065103 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(2-morpholin-4-ylethylsulfanyl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(SCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2S/c22-19(17-7-3-1-4-8-17)20(18-9-5-2-6-10-18)24-16-13-21-11-14-23-15-12-21/h1-10,20H,11-16H2 |
| InChIKey | BXHNBDYKNNPDPG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |