C19H16N2O2S — CID 134065469
2-[(4-methoxyphenyl)methyl]-5-(3-phenylprop-2-ynylsulfanyl)-1,3,4-oxadiazole (PubChem CID 134065469) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-5-(3-phenylprop-2-ynylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-5-(3-phenylprop-2-ynylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 134065469 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-5-(3-phenylprop-2-ynylsulfanyl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(Cc2nnc(SCC#Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H16N2O2S/c1-22-17-11-9-16(10-12-17)14-18-20-21-19(23-18)24-13-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-12H,13-14H2,1H3 |
| InChIKey | VBGOWCDQJHNINM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|