C24H19NO3S — CID 134065804
4,5-diphenyl-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-oxazole (PubChem CID 134065804) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4,5-diphenyl-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-oxazole.
| Compound Name | 4,5-diphenyl-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-oxazole |
|---|---|
| PubChem CID | 134065804 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4,5-diphenyl-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-oxazole |
| SMILES | c1ccc(-c2nc(SC3(c4ccccc4)OCCO3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19NO3S/c1-4-10-18(11-5-1)21-22(19-12-6-2-7-13-19)28-23(25-21)29-24(26-16-17-27-24)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | DTKPNFWZEQIMHG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |