About 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole
5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole (PubChem CID 134065815) has the molecular formula C16H12ClNO3S
and a molecular weight of 333.80 g/mol. Its IUPAC name is 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole |
| PubChem CID | 134065815 |
| Molecular Formula | C16H12ClNO3S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(SC3(c4ccccc4)OCCO3)nc2c1 |
| InChI | InChI=1S/C16H12ClNO3S/c17-12-6-7-14-13(10-12)18-15(21-14)22-16(19-8-9-20-16)11-4-2-1-3-5-11/h1-7,10H,8-9H2 |
| InChIKey | ORNPLAGETVOOPH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole?
The IUPAC name of 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole (CID 134065815) is 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole.
What is the SMILES notation for 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole?
The canonical SMILES for 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole is Clc1ccc2oc(SC3(c4ccccc4)OCCO3)nc2c1.
What is the InChIKey of 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole?
The InChIKey is ORNPLAGETVOOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO3S/c17-12-6-7-14-13(10-12)18-15(21-14)22-16(19-8-9-20-16)11-4-2-1-3-5-11/h1-7,10H,8-9H2.
What are the key properties of 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole?
5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole has a molecular weight of 333.80 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(2-phenyl-1,3-dioxolan-2-yl)sulfanyl]-1,3-benzoxazole is sourced from PubChem (CID 134065815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).