C9H16O — CID 13406603
4-butoxy-3-methylbuta-1,2-diene (PubChem CID 13406603) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-butoxy-3-methylbuta-1,2-diene.
| Compound Name | 4-butoxy-3-methylbuta-1,2-diene |
|---|---|
| PubChem CID | 13406603 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 4-butoxy-3-methylbuta-1,2-diene |
| SMILES | C=C=C(C)COCCCC |
| InChI | InChI=1S/C9H16O/c1-4-6-7-10-8-9(3)5-2/h2,4,6-8H2,1,3H3 |
| InChIKey | HHFKFTJTHWKZTD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|