About 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene
3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene (PubChem CID 13406612) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene.
Molecular Properties
| Compound Name | 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene |
| PubChem CID | 13406612 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene |
| SMILES | C=C=C(C(CC(C)C)OCC)C(C)(C)C |
| InChI | InChI=1S/C14H26O/c1-8-12(14(5,6)7)13(15-9-2)10-11(3)4/h11,13H,1,9-10H2,2-7H3 |
| InChIKey | GDQKBKYRMPDLCD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene?
The IUPAC name of 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene (CID 13406612) is 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene.
What is the SMILES notation for 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene?
The canonical SMILES for 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene is C=C=C(C(CC(C)C)OCC)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene?
The InChIKey is GDQKBKYRMPDLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-8-12(14(5,6)7)13(15-9-2)10-11(3)4/h11,13H,1,9-10H2,2-7H3.
What are the key properties of 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene?
3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene has a molecular weight of 210.36 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-ethoxy-6-methylhepta-1,2-diene is sourced from PubChem (CID 13406612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).