C13H13FO4S — CID 134066412
3-(4-fluoronaphthalen-1-yl)sulfonylpropane-1,2-diol (PubChem CID 134066412) has the molecular formula C13H13FO4S and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-(4-fluoronaphthalen-1-yl)sulfonylpropane-1,2-diol.
| Compound Name | 3-(4-fluoronaphthalen-1-yl)sulfonylpropane-1,2-diol |
|---|---|
| PubChem CID | 134066412 |
| Molecular Formula | C13H13FO4S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-(4-fluoronaphthalen-1-yl)sulfonylpropane-1,2-diol |
| SMILES | O=S(=O)(CC(O)CO)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C13H13FO4S/c14-12-5-6-13(11-4-2-1-3-10(11)12)19(17,18)8-9(16)7-15/h1-6,9,15-16H,7-8H2 |
| InChIKey | LAFURGINCHNXQX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |