C20H16BrN5O2S — CID 134066676
2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4H-1,3,4-benzoxadiazepin-5-one (PubChem CID 134066676) has the molecular formula C20H16BrN5O2S and a molecular weight of 470.35 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4H-1,3,4-benzoxadiazepin-5-one.
| Compound Name | 2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4H-1,3,4-benzoxadiazepin-5-one |
|---|---|
| PubChem CID | 134066676 |
| Molecular Formula | C20H16BrN5O2S |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4H-1,3,4-benzoxadiazepin-5-one |
| SMILES | C=CCn1nc(SCC2=NNC(=O)c3ccccc3O2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrN5O2S/c1-2-11-26-18(13-7-9-14(21)10-8-13)22-20(25-26)29-12-17-23-24-19(27)15-5-3-4-6-16(15)28-17/h2-10H,1,11-12H2,(H,24,27) |
| InChIKey | LYSYAPKMWYQCAG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|