About (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine
(2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine (PubChem CID 134067985) has the molecular formula C28H28NP
and a molecular weight of 409.51 g/mol. Its IUPAC name is (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine.
Molecular Properties
| Compound Name | (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine |
| PubChem CID | 134067985 |
| Molecular Formula | C28H28NP |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine |
| SMILES | N[C@H](Cc1ccccc1)[C@@H](Cc1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28NP/c29-27(21-23-13-5-1-6-14-23)28(22-24-15-7-2-8-16-24)30(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-28H,21-22,29H2/t27-,28-/m1/s1 |
| InChIKey | VIRVQNGBKNYNCL-VSGBNLITSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine?
The IUPAC name of (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine (CID 134067985) is (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine.
What is the SMILES notation for (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine?
The canonical SMILES for (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine is N[C@H](Cc1ccccc1)[C@@H](Cc1ccccc1)P(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine?
The InChIKey is VIRVQNGBKNYNCL-VSGBNLITSA-N. The full InChI is InChI=1S/C28H28NP/c29-27(21-23-13-5-1-6-14-23)28(22-24-15-7-2-8-16-24)30(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-28H,21-22,29H2/t27-,28-/m1/s1.
What are the key properties of (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine?
(2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine has a molecular weight of 409.51 g/mol, XLogP of 5.30, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-diphenylphosphanyl-1,4-diphenylbutan-2-amine is sourced from PubChem (CID 134067985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).