C10H11NO5 — CID 13406824
6,7,8-trihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 13406824) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 6,7,8-trihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | 6,7,8-trihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 13406824 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6,7,8-trihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(O)c(O)c(O)c2CN1 |
| InChI | InChI=1S/C10H11NO5/c12-7-2-4-1-6(10(15)16)11-3-5(4)8(13)9(7)14/h2,6,11-14H,1,3H2,(H,15,16) |
| InChIKey | WHBSBHYBVNVORL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|