C10H11ClN2O4 — CID 13406829
7-nitro-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (PubChem CID 13406829) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 7-nitro-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | 7-nitro-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 13406829 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 7-nitro-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1Cc2ccc([N+](=O)[O-])cc2CN1 |
| InChI | InChI=1S/C10H10N2O4.ClH/c13-10(14)9-4-6-1-2-8(12(15)16)3-7(6)5-11-9;/h1-3,9,11H,4-5H2,(H,13,14);1H |
| InChIKey | IIJHKJCIKSMSTR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|