C23H20FN3O4 — CID 1340684
(4R)-N-(4-fluorophenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 1340684) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is (4R)-N-(4-fluorophenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R)-N-(4-fluorophenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1340684 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (4R)-N-(4-fluorophenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2)[C@H](c2cccc([N+](=O)[O-])c2)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C23H20FN3O4/c1-13-20(23(29)26-16-10-8-15(24)9-11-16)21(14-4-2-5-17(12-14)27(30)31)22-18(25-13)6-3-7-19(22)28/h2,4-5,8-12,21,25H,3,6-7H2,1H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | ZRVDYOMUFRTRRN-NRFANRHFSA-N |
| XLogP | 4.34 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|