C17H24O11 — CID 13407020
tetramethyl (2R,3R,5S,6S)-1-(dimethoxymethyl)-7-oxabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate (PubChem CID 13407020) has the molecular formula C17H24O11 and a molecular weight of 404.37 g/mol. Its IUPAC name is tetramethyl (2R,3R,5S,6S)-1-(dimethoxymethyl)-7-oxabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl (2R,3R,5S,6S)-1-(dimethoxymethyl)-7-oxabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 13407020 |
| Molecular Formula | C17H24O11 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | tetramethyl (2R,3R,5S,6S)-1-(dimethoxymethyl)-7-oxabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)[C@@H]1C2OC(C(OC)OC)([C@H](C(=O)OC)[C@H]2C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H24O11/c1-22-12(18)7-9(14(20)24-3)17(16(26-5)27-6)10(15(21)25-4)8(11(7)28-17)13(19)23-2/h7-11,16H,1-6H3/t7-,8+,9+,10-,11?,17? |
| InChIKey | OPHGJBBFKJONQC-OBRQWUDRSA-N |
| XLogP | -1.09 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|