About 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane
4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (PubChem CID 134070475) has the molecular formula C14H24N4O4S
and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| PubChem CID | 134070475 |
| Molecular Formula | C14H24N4O4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| SMILES | Cn1cncc1CN1CCOC2(COCCN(S(C)(=O)=O)C2)C1 |
| InChI | InChI=1S/C14H24N4O4S/c1-16-12-15-7-13(16)8-17-3-6-22-14(9-17)10-18(23(2,19)20)4-5-21-11-14/h7,12H,3-6,8-11H2,1-2H3 |
| InChIKey | AYDVSXMRVPKTQH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The IUPAC name of 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (CID 134070475) is 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
What is the SMILES notation for 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The canonical SMILES for 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane is Cn1cncc1CN1CCOC2(COCCN(S(C)(=O)=O)C2)C1.
What is the InChIKey of 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The InChIKey is AYDVSXMRVPKTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O4S/c1-16-12-15-7-13(16)8-17-3-6-22-14(9-17)10-18(23(2,19)20)4-5-21-11-14/h7,12H,3-6,8-11H2,1-2H3.
What are the key properties of 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane has a molecular weight of 344.44 g/mol, XLogP of -0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methylimidazol-4-yl)methyl]-8-methylsulfonyl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane is sourced from PubChem (CID 134070475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).