C18H26N2O2S — CID 134070679
6-(cyclopropylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine (PubChem CID 134070679) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine.
| Compound Name | 6-(cyclopropylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 134070679 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 6-(cyclopropylmethyl)-1-methylsulfonyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine |
| SMILES | CS(=O)(=O)N1CCC2(c3ccccc3)CCN(CC3CC3)CC12 |
| InChI | InChI=1S/C18H26N2O2S/c1-23(21,22)20-12-10-18(16-5-3-2-4-6-16)9-11-19(14-17(18)20)13-15-7-8-15/h2-6,15,17H,7-14H2,1H3 |
| InChIKey | IIUVLIXQUBIUBM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |