C14H18F3N3O2 — CID 134074410
6-(methoxymethyl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 134074410) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 6-(methoxymethyl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 6-(methoxymethyl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 134074410 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-(methoxymethyl)-4-[6-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | COCC1CC2OCCN(c3cc(C(F)(F)F)ncn3)C2C1 |
| InChI | InChI=1S/C14H18F3N3O2/c1-21-7-9-4-10-11(5-9)22-3-2-20(10)13-6-12(14(15,16)17)18-8-19-13/h6,8-11H,2-5,7H2,1H3 |
| InChIKey | MAVXFMJFJUUPTG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |