C18H21NO3S — CID 134074577
(9-methoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl)-(3-methyl-1-benzothiophen-2-yl)methanone (PubChem CID 134074577) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (9-methoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl)-(3-methyl-1-benzothiophen-2-yl)methanone.
| Compound Name | (9-methoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl)-(3-methyl-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 134074577 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (9-methoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl)-(3-methyl-1-benzothiophen-2-yl)methanone |
| SMILES | COC1C2CCC1N(C(=O)c1sc3ccccc3c1C)CCO2 |
| InChI | InChI=1S/C18H21NO3S/c1-11-12-5-3-4-6-15(12)23-17(11)18(20)19-9-10-22-14-8-7-13(19)16(14)21-2/h3-6,13-14,16H,7-10H2,1-2H3 |
| InChIKey | TYXWUDDSVQRLNI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |