About (3S)-3-methoxy-4,4-dimethyloxolan-2-one
(3S)-3-methoxy-4,4-dimethyloxolan-2-one (PubChem CID 13407497) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is (3S)-3-methoxy-4,4-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | (3S)-3-methoxy-4,4-dimethyloxolan-2-one |
| PubChem CID | 13407497 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3S)-3-methoxy-4,4-dimethyloxolan-2-one |
| SMILES | CO[C@@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C7H12O3/c1-7(2)4-10-6(8)5(7)9-3/h5H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | YAADWXYUBQRRJJ-RXMQYKEDSA-N |
| XLogP | 0.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-methoxy-4,4-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methoxy-4,4-dimethyloxolan-2-one?
The IUPAC name of (3S)-3-methoxy-4,4-dimethyloxolan-2-one (CID 13407497) is (3S)-3-methoxy-4,4-dimethyloxolan-2-one.
What is the SMILES notation for (3S)-3-methoxy-4,4-dimethyloxolan-2-one?
The canonical SMILES for (3S)-3-methoxy-4,4-dimethyloxolan-2-one is CO[C@@H]1C(=O)OCC1(C)C.
What is the InChIKey of (3S)-3-methoxy-4,4-dimethyloxolan-2-one?
The InChIKey is YAADWXYUBQRRJJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H12O3/c1-7(2)4-10-6(8)5(7)9-3/h5H,4H2,1-3H3/t5-/m1/s1.
What are the key properties of (3S)-3-methoxy-4,4-dimethyloxolan-2-one?
(3S)-3-methoxy-4,4-dimethyloxolan-2-one has a molecular weight of 144.17 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methoxy-4,4-dimethyloxolan-2-one is sourced from PubChem (CID 13407497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).