C16H22FN7O — CID 134076131
N-[2-(dimethylamino)ethyl]-5-(5-fluoropyrimidin-2-yl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-7-carboxamide (PubChem CID 134076131) has the molecular formula C16H22FN7O and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-(5-fluoropyrimidin-2-yl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-7-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-(5-fluoropyrimidin-2-yl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-7-carboxamide |
|---|---|
| PubChem CID | 134076131 |
| Molecular Formula | C16H22FN7O |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-(5-fluoropyrimidin-2-yl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-7-carboxamide |
| SMILES | CN(C)CCNC(=O)C1CN(c2ncc(F)cn2)Cc2ccnn2C1 |
| InChI | InChI=1S/C16H22FN7O/c1-22(2)6-5-18-15(25)12-9-23(16-19-7-13(17)8-20-16)11-14-3-4-21-24(14)10-12/h3-4,7-8,12H,5-6,9-11H2,1-2H3,(H,18,25) |
| InChIKey | GVOTWOYKFMEZMI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |