About (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone
(7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone (PubChem CID 134076233) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone.
Molecular Properties
| Compound Name | (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone |
| PubChem CID | 134076233 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone |
| SMILES | CCN1CCC2(C1)CN(C(=O)C1CCOC1)C2 |
| InChI | InChI=1S/C13H22N2O2/c1-2-14-5-4-13(8-14)9-15(10-13)12(16)11-3-6-17-7-11/h11H,2-10H2,1H3 |
| InChIKey | XXPFDJYDHITLPT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone?
The IUPAC name of (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone (CID 134076233) is (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone.
What is the SMILES notation for (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone?
The canonical SMILES for (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone is CCN1CCC2(C1)CN(C(=O)C1CCOC1)C2.
What is the InChIKey of (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone?
The InChIKey is XXPFDJYDHITLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-2-14-5-4-13(8-14)9-15(10-13)12(16)11-3-6-17-7-11/h11H,2-10H2,1H3.
What are the key properties of (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone?
(7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone has a molecular weight of 238.33 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-2,7-diazaspiro[3.4]octan-2-yl)-(oxolan-3-yl)methanone is sourced from PubChem (CID 134076233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).