About 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine
8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 134076295) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine.
Molecular Properties
| Compound Name | 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| PubChem CID | 134076295 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | CN(C)C1COC2(CCN(CC3CCC3)CC2)C1 |
| InChI | InChI=1S/C15H28N2O/c1-16(2)14-10-15(18-12-14)6-8-17(9-7-15)11-13-4-3-5-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | BHSVVGSITPKZTH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The IUPAC name of 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine (CID 134076295) is 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine.
What is the SMILES notation for 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The canonical SMILES for 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine is CN(C)C1COC2(CCN(CC3CCC3)CC2)C1.
What is the InChIKey of 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The InChIKey is BHSVVGSITPKZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-16(2)14-10-15(18-12-14)6-8-17(9-7-15)11-13-4-3-5-13/h13-14H,3-12H2,1-2H3.
What are the key properties of 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine?
8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine has a molecular weight of 252.40 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(cyclobutylmethyl)-N,N-dimethyl-1-oxa-8-azaspiro[4.5]decan-3-amine is sourced from PubChem (CID 134076295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).