C18H21N3O4S — CID 134076435
4-[2-cyclopropylsulfonyl-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-5-yl]morpholine (PubChem CID 134076435) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[2-cyclopropylsulfonyl-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-5-yl]morpholine.
| Compound Name | 4-[2-cyclopropylsulfonyl-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-5-yl]morpholine |
|---|---|
| PubChem CID | 134076435 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[2-cyclopropylsulfonyl-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-5-yl]morpholine |
| SMILES | O=S(=O)(C1CC1)N1Cc2cc(N3CCOCC3)ccc2C1c1cnco1 |
| InChI | InChI=1S/C18H21N3O4S/c22-26(23,15-2-3-15)21-11-13-9-14(20-5-7-24-8-6-20)1-4-16(13)18(21)17-10-19-12-25-17/h1,4,9-10,12,15,18H,2-3,5-8,11H2 |
| InChIKey | ZXDXTWRDWFXMGJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|