C19H25FN2O — CID 134076658
9-[(4-fluorophenyl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.6]undecan-2-one (PubChem CID 134076658) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 9-[(4-fluorophenyl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | 9-[(4-fluorophenyl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 134076658 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 9-[(4-fluorophenyl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.6]undecan-2-one |
| SMILES | C=CCN1C(=O)CCC12CCCN(Cc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C19H25FN2O/c1-2-12-22-18(23)8-10-19(22)9-3-13-21(14-11-19)15-16-4-6-17(20)7-5-16/h2,4-7H,1,3,8-15H2 |
| InChIKey | YXBALKQIGZACNZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|