About 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol
2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol (PubChem CID 134077407) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol |
| PubChem CID | 134077407 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol |
| SMILES | Cc1ccc2c(c1)C(N(C)CCO)CC21CCNCC1 |
| InChI | InChI=1S/C17H26N2O/c1-13-3-4-15-14(11-13)16(19(2)9-10-20)12-17(15)5-7-18-8-6-17/h3-4,11,16,18,20H,5-10,12H2,1-2H3 |
| InChIKey | FUVVQXAPWVPAGQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The IUPAC name of 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol (CID 134077407) is 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol.
What is the SMILES notation for 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The canonical SMILES for 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol is Cc1ccc2c(c1)C(N(C)CCO)CC21CCNCC1.
What is the InChIKey of 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The InChIKey is FUVVQXAPWVPAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-13-3-4-15-14(11-13)16(19(2)9-10-20)12-17(15)5-7-18-8-6-17/h3-4,11,16,18,20H,5-10,12H2,1-2H3.
What are the key properties of 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol has a molecular weight of 274.41 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol is sourced from PubChem (CID 134077407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).