About oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone
oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone (PubChem CID 134077664) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone.
Molecular Properties
| Compound Name | oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone |
| PubChem CID | 134077664 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone |
| SMILES | O=C(C1CCOC1)N1CCC2(CC1)CN(c1cccnc1)c1ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c26-21(17-7-13-27-15-17)24-11-8-22(9-12-24)16-25(18-4-3-10-23-14-18)20-6-2-1-5-19(20)22/h1-6,10,14,17H,7-9,11-13,15-16H2 |
| InChIKey | JXNAFRFDRIDPIH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone?
The IUPAC name of oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone (CID 134077664) is oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone.
What is the SMILES notation for oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone?
The canonical SMILES for oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone is O=C(C1CCOC1)N1CCC2(CC1)CN(c1cccnc1)c1ccccc12.
What is the InChIKey of oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone?
The InChIKey is JXNAFRFDRIDPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c26-21(17-7-13-27-15-17)24-11-8-22(9-12-24)16-25(18-4-3-10-23-14-18)20-6-2-1-5-19(20)22/h1-6,10,14,17H,7-9,11-13,15-16H2.
What are the key properties of oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone?
oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone has a molecular weight of 363.46 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl-(1-pyridin-3-ylspiro[2H-indole-3,4'-piperidine]-1'-yl)methanone is sourced from PubChem (CID 134077664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).