C15H20N2O4 — CID 134078324
1,2-oxazol-5-yl-[6-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone (PubChem CID 134078324) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1,2-oxazol-5-yl-[6-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone.
| Compound Name | 1,2-oxazol-5-yl-[6-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
|---|---|
| PubChem CID | 134078324 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1,2-oxazol-5-yl-[6-(prop-2-enoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
| SMILES | C=CCOCC1CC2OCCN(C(=O)c3ccno3)C2C1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-6-19-10-11-8-12-14(9-11)20-7-5-17(12)15(18)13-3-4-16-21-13/h2-4,11-12,14H,1,5-10H2 |
| InChIKey | XXTBVYDXMUGQRC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|