C4BrF9N2 — CID 13407868
1-bromo-2,2,4,4,5,5-hexafluoro-3-(trifluoromethyl)imidazolidine (PubChem CID 13407868) has the molecular formula C4BrF9N2 and a molecular weight of 326.94 g/mol. Its IUPAC name is 1-bromo-2,2,4,4,5,5-hexafluoro-3-(trifluoromethyl)imidazolidine.
| Compound Name | 1-bromo-2,2,4,4,5,5-hexafluoro-3-(trifluoromethyl)imidazolidine |
|---|---|
| PubChem CID | 13407868 |
| Molecular Formula | C4BrF9N2 |
| Molecular Weight | 326.94 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 1-bromo-2,2,4,4,5,5-hexafluoro-3-(trifluoromethyl)imidazolidine |
| SMILES | FC(F)(F)N1C(F)(F)N(Br)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4BrF9N2/c5-16-2(8,9)1(6,7)15(3(10,11)12)4(16,13)14 |
| InChIKey | HXZZZUQGEWENIF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|