About 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide
2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide (PubChem CID 134079017) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide |
| PubChem CID | 134079017 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCCC12CCN(CC(C)O)CC2 |
| InChI | InChI=1S/C14H27N3O2/c1-12(18)10-16-8-5-14(6-9-16)4-3-7-17(14)11-13(19)15-2/h12,18H,3-11H2,1-2H3,(H,15,19) |
| InChIKey | RZYAFFWVUNXSLG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide?
The IUPAC name of 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide (CID 134079017) is 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide.
What is the SMILES notation for 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide?
The canonical SMILES for 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide is CNC(=O)CN1CCCC12CCN(CC(C)O)CC2.
What is the InChIKey of 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide?
The InChIKey is RZYAFFWVUNXSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-12(18)10-16-8-5-14(6-9-16)4-3-7-17(14)11-13(19)15-2/h12,18H,3-11H2,1-2H3,(H,15,19).
What are the key properties of 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide?
2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide has a molecular weight of 269.39 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-(2-hydroxypropyl)-1,8-diazaspiro[4.5]decan-1-yl]-N-methylacetamide is sourced from PubChem (CID 134079017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).