C12H15ClN4O2 — CID 134080319
3-(5-chloro-3-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 134080319) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is 3-(5-chloro-3-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 3-(5-chloro-3-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 134080319 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-(5-chloro-3-pyridinyl)-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | O=[N+]([O-])C1CCC2NNC(c3cncc(Cl)c3)C2C1 |
| InChI | InChI=1S/C12H15ClN4O2/c13-8-3-7(5-14-6-8)12-10-4-9(17(18)19)1-2-11(10)15-16-12/h3,5-6,9-12,15-16H,1-2,4H2 |
| InChIKey | GNJCDCXNUOBBTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|