C15H20N6O2 — CID 134080956
5-(2-hydroxyphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]pyrazolidine-3-carboxamide (PubChem CID 134080956) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(2-hydroxyphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134080956 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-(2-hydroxyphenyl)-N-[1-(1,2,4-triazol-1-yl)propan-2-yl]pyrazolidine-3-carboxamide |
| SMILES | CC(Cn1cncn1)NC(=O)C1CC(c2ccccc2O)NN1 |
| InChI | InChI=1S/C15H20N6O2/c1-10(7-21-9-16-8-17-21)18-15(23)13-6-12(19-20-13)11-4-2-3-5-14(11)22/h2-5,8-10,12-13,19-20,22H,6-7H2,1H3,(H,18,23) |
| InChIKey | TVWXJVVRSDEFSJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|