C21H27N5O — CID 134081045
3-phenyl-N-[(1-pyridin-2-ylpiperidin-3-yl)methyl]pyrazolidine-4-carboxamide (PubChem CID 134081045) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-phenyl-N-[(1-pyridin-2-ylpiperidin-3-yl)methyl]pyrazolidine-4-carboxamide.
| Compound Name | 3-phenyl-N-[(1-pyridin-2-ylpiperidin-3-yl)methyl]pyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 134081045 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-phenyl-N-[(1-pyridin-2-ylpiperidin-3-yl)methyl]pyrazolidine-4-carboxamide |
| SMILES | O=C(NCC1CCCN(c2ccccn2)C1)C1CNNC1c1ccccc1 |
| InChI | InChI=1S/C21H27N5O/c27-21(18-14-24-25-20(18)17-8-2-1-3-9-17)23-13-16-7-6-12-26(15-16)19-10-4-5-11-22-19/h1-5,8-11,16,18,20,24-25H,6-7,12-15H2,(H,23,27) |
| InChIKey | WGIIOYKNSRJJGI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |