About (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine
(1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine (PubChem CID 134081383) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine.
Molecular Properties
| Compound Name | (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine |
| PubChem CID | 134081383 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine |
| SMILES | CCC1CCCC/C1=C1\CCc2cc(N)ccc21 |
| InChI | InChI=1S/C17H23N/c1-2-12-5-3-4-6-15(12)17-9-7-13-11-14(18)8-10-16(13)17/h8,10-12H,2-7,9,18H2,1H3/b17-15- |
| InChIKey | MWTGITXAGYYHNL-ICFOKQHNSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine?
The IUPAC name of (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine (CID 134081383) is (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine.
What is the SMILES notation for (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine?
The canonical SMILES for (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine is CCC1CCCC/C1=C1\CCc2cc(N)ccc21.
What is the InChIKey of (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine?
The InChIKey is MWTGITXAGYYHNL-ICFOKQHNSA-N. The full InChI is InChI=1S/C17H23N/c1-2-12-5-3-4-6-15(12)17-9-7-13-11-14(18)8-10-16(13)17/h8,10-12H,2-7,9,18H2,1H3/b17-15-.
What are the key properties of (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine?
(1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine has a molecular weight of 241.38 g/mol, XLogP of 4.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(2-ethylcyclohexylidene)-2,3-dihydroinden-5-amine is sourced from PubChem (CID 134081383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).