C21H19FN4O2S — CID 134082251
1-[(4-fluorophenyl)methyl]-5-[2-(furan-2-ylmethylamino)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide (PubChem CID 134082251) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-[2-(furan-2-ylmethylamino)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-[2-(furan-2-ylmethylamino)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134082251 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-[2-(furan-2-ylmethylamino)-1,3-thiazol-4-yl]-2-methylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)cc(-c2csc(NCc3ccco3)n2)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN4O2S/c1-13-17(20(23)27)9-19(26(13)11-14-4-6-15(22)7-5-14)18-12-29-21(25-18)24-10-16-3-2-8-28-16/h2-9,12H,10-11H2,1H3,(H2,23,27)(H,24,25) |
| InChIKey | AUPKPKPYILLOLS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_C(3)', 'substructure': 'N/A'} |
|---|