C28H27N3O5 — CID 134082791
N-benzyl-2-[5-benzyl-3-(3-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide (PubChem CID 134082791) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-benzyl-2-[5-benzyl-3-(3-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide.
| Compound Name | N-benzyl-2-[5-benzyl-3-(3-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
|---|---|
| PubChem CID | 134082791 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-benzyl-2-[5-benzyl-3-(3-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
| SMILES | COc1cccc(C2C3C(=O)N(Cc4ccccc4)C(=O)C3ON2CC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H27N3O5/c1-35-22-14-8-13-21(15-22)25-24-26(28(34)30(27(24)33)17-20-11-6-3-7-12-20)36-31(25)18-23(32)29-16-19-9-4-2-5-10-19/h2-15,24-26H,16-18H2,1H3,(H,29,32) |
| InChIKey | OGCLWOXERBGDMA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|